Product name:L-leucine
Description:White crystals
|
Leucine |
|
|
IUPAC name Leucine |
|
|
Other names 2-Amino-4-methylpentanoic acid |
|
|
Identifiers |
|
|
CAS number |
61-90-5 |
|
PubChem |
6106 |
|
ChemSpider |
5880 |
|
UNII |
GMW67QNF9C |
|
ChEMBL |
CHEMBL291962 |
|
SMILES
CC(C)C[C@@H](C(=O)O)N |
|
|
InChI InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 |
|
|
Properties |
|
|
Molecular formula |
C6H13NO2 |
|
Molar mass |
131.17 g mol−1 |
|
Acidity (pKa) |
2.36 (carboxyl), 9.60 (amino) |
|
Supplementary data page |
|
|
Structure and |
n, εr, etc. |
|
Thermodynamic |
Phase behaviour |
L-Leucine
L-Leucine can be a valuable tool in not only muscle building but can also play a critical role in weight loss.
What is L-Leucine?
L-Leucine is an essential amino acid, which means that the body doesn’t produce it naturally.
Recent research has discovered that L-Leucine acts in a unique way: it can help burn fat without burning muscle. That’s a bit of a head scratcher because aminos are responsible for getting nutrients to the individual cells to burn – but usually aren’t discretionary about what nutrients it takes to the “furnace”.
As mentioned previously, L-Leucine seems to be different; they found that L-Leucine actually spares the muscle proteins, leaving them to help build and increase muscle gain and mass.
At this time there have been no known major side effects with taking L-Leucine. Usually when a substance like L-Leucine is produced organically in nature, and if proper dosage amounts are used, then the chances for side effects really drop. That is consistent with L-Leucine.
Specification:
|
Description |
White crystals or crystals powder |
|
Identification |
Infrared absorption |
|
Specific rotation[a]D20° |
+14.9°~+17.3° |
|
State of solution |
≥98.0% |
|
Chloride(Cl) |
≤0.050% |
|
Sulfate(SO4) |
≤0.030% |
|
Iron(Fe) |
≤30PPm |
|
Heavy metals(Pb) |
≤15PPm |
|
Lead (Pb) |
≤5PPm |
|
Arsenic(As2O3) |
≤1PPm |
|
Other amino acids |
Conform |
|
Organic volatile impurities |
Meets the requirements |
|
Residual solvents |
Meets the requirements |
|
Loss on drying |
≤0.20% |
|
Residue on ignition(Sulfated) |
≤0.10% |
|
Solubility in water |
Meets the requirements |
|
Assay |
98.5~101.5% |
|
PH5 |
5~6.5 |