O=C(N[C@@H](C(O)=O)CC1=NC2=CC=CC=C2C=C1)OCC3C(C=CC=C4)=C4C5=C3C=CC=C5
Off-white powder
Fmoc-3-(2-Quinolyl)-D-Ala-OH is a protected D-alanine derivative featuring a quinoline moiety, widely utilized in solid-phase peptide synthesis. The compound serves as a critical building block for constructing complex peptidomimetics with enhanced metabolic stability. Its core process involves the coupling of Fmoc-chloride with 3-(2-quinolyl)-D-alanine followed by rigorous purification to ensure high optical purity.
Molecular Formula: C24H20N2O4 | CAS No: 159876-88-3Strictly store under inert atmosphere at -20°C to prevent hydrolysis and racemization. Handle with appropriate PPE due to potential skin sensitization; avoid inhalation of dust. Not intended for direct clinical use without further formulation into approved therapeutic agents.